C19H24N2O2 — CID 57374985
2-[1-[2-(1H-indol-3-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]butanoic acid (PubChem CID 57374985) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[1-[2-(1H-indol-3-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]butanoic acid.
| Compound Name | 2-[1-[2-(1H-indol-3-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]butanoic acid |
|---|---|
| PubChem CID | 57374985 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[1-[2-(1H-indol-3-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]butanoic acid |
| SMILES | CCC(C(=O)O)C1=CCCN(CCc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C19H24N2O2/c1-2-16(19(22)23)15-6-5-10-21(13-15)11-9-14-12-20-18-8-4-3-7-17(14)18/h3-4,6-8,12,16,20H,2,5,9-11,13H2,1H3,(H,22,23) |
| InChIKey | IZNNBGRCPFYTFH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|