C20H13N2O5- — CID 57375107
2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate (PubChem CID 57375107) has the molecular formula C20H13N2O5- and a molecular weight of 361.33 g/mol. Its IUPAC name is 2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate.
| Compound Name | 2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate |
|---|---|
| PubChem CID | 57375107 |
| Molecular Formula | C20H13N2O5- |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-(2,7,12-trioxo-1H-naphtho[2,3-f]quinoxalin-3-yl)butanoate |
| SMILES | CCC(C(=O)[O-])c1nc2ccc3c(c2[nH]c1=O)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C20H14N2O5/c1-2-9(20(26)27)15-19(25)22-16-13(21-15)8-7-12-14(16)18(24)11-6-4-3-5-10(11)17(12)23/h3-9H,2H2,1H3,(H,22,25)(H,26,27)/p-1 |
| InChIKey | DUWCCANJWCKLSW-UHFFFAOYSA-M |
| XLogP | 0.94 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|