About thiophene-2,3-dicarbaldehyde
thiophene-2,3-dicarbaldehyde (PubChem CID 573752) has the molecular formula C6H4O2S
and a molecular weight of 140.16 g/mol. Its IUPAC name is thiophene-2,3-dicarbaldehyde.
Molecular Properties
| Compound Name | thiophene-2,3-dicarbaldehyde |
| PubChem CID | 573752 |
| Molecular Formula | C6H4O2S |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 139.99 |
| IUPAC Name | thiophene-2,3-dicarbaldehyde |
| SMILES | O=Cc1ccsc1C=O |
| InChI | InChI=1S/C6H4O2S/c7-3-5-1-2-9-6(5)4-8/h1-4H |
| InChIKey | WSEJZRIZDQWMKQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze thiophene-2,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-2,3-dicarbaldehyde?
The IUPAC name of thiophene-2,3-dicarbaldehyde (CID 573752) is thiophene-2,3-dicarbaldehyde.
What is the SMILES notation for thiophene-2,3-dicarbaldehyde?
The canonical SMILES for thiophene-2,3-dicarbaldehyde is O=Cc1ccsc1C=O.
What is the InChIKey of thiophene-2,3-dicarbaldehyde?
The InChIKey is WSEJZRIZDQWMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2S/c7-3-5-1-2-9-6(5)4-8/h1-4H.
What are the key properties of thiophene-2,3-dicarbaldehyde?
thiophene-2,3-dicarbaldehyde has a molecular weight of 140.16 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-2,3-dicarbaldehyde is sourced from PubChem (CID 573752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).