C10H22NOP — CID 57375367
3-ethyl-2,2,3,4,4-pentamethyl-1-oxo-1λ5-phosphetan-1-amine (PubChem CID 57375367) has the molecular formula C10H22NOP and a molecular weight of 203.27 g/mol. Its IUPAC name is 3-ethyl-2,2,3,4,4-pentamethyl-1-oxo-1λ5-phosphetan-1-amine.
| Compound Name | 3-ethyl-2,2,3,4,4-pentamethyl-1-oxo-1λ5-phosphetan-1-amine |
|---|---|
| PubChem CID | 57375367 |
| Molecular Formula | C10H22NOP |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-ethyl-2,2,3,4,4-pentamethyl-1-oxo-1λ5-phosphetan-1-amine |
| SMILES | CCC1(C)C(C)(C)P(N)(=O)C1(C)C |
| InChI | InChI=1S/C10H22NOP/c1-7-10(6)8(2,3)13(11,12)9(10,4)5/h7H2,1-6H3,(H2,11,12) |
| InChIKey | JCSHHXARHGJSJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|