C9H16N2S — CID 57375407
3-ethyl-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]thiazin-1-imine (PubChem CID 57375407) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 3-ethyl-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]thiazin-1-imine.
| Compound Name | 3-ethyl-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]thiazin-1-imine |
|---|---|
| PubChem CID | 57375407 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 3-ethyl-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]thiazin-1-imine |
| SMILES | [H]/N=C1\SC(CC)CC2CCCN12 |
| InChI | InChI=1S/C9H16N2S/c1-2-8-6-7-4-3-5-11(7)9(10)12-8/h7-8,10H,2-6H2,1H3/b10-9- |
| InChIKey | VPKNLFLWKCPHLI-KTKRTIGZSA-N |
| XLogP | 2.30 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|