C18H10 — CID 57375439
pentacyclo[9.5.2.02,7.08,17.014,18]octadeca-1,3,5,7,9,11,13,15,17-nonaene (PubChem CID 57375439) has the molecular formula C18H10 and a molecular weight of 226.28 g/mol. Its IUPAC name is pentacyclo[9.5.2.02,7.08,17.014,18]octadeca-1,3,5,7,9,11,13,15,17-nonaene.
| Compound Name | pentacyclo[9.5.2.02,7.08,17.014,18]octadeca-1,3,5,7,9,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 57375439 |
| Molecular Formula | C18H10 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | pentacyclo[9.5.2.02,7.08,17.014,18]octadeca-1,3,5,7,9,11,13,15,17-nonaene |
| SMILES | C1=c2ccc3c4c(ccc(c24)=C1)=c1ccccc1=3 |
| InChI | InChI=1S/C18H10/c1-2-4-14-13(3-1)15-9-7-11-5-6-12-8-10-16(14)18(15)17(11)12/h1-10H |
| InChIKey | GILUNAKNHXUOQI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |