About 6H-indeno[4,5-g][1,3]benzothiazole
6H-indeno[4,5-g][1,3]benzothiazole (PubChem CID 57375463) has the molecular formula C14H9NS
and a molecular weight of 223.30 g/mol. Its IUPAC name is 6H-indeno[4,5-g][1,3]benzothiazole.
Molecular Properties
| Compound Name | 6H-indeno[4,5-g][1,3]benzothiazole |
| PubChem CID | 57375463 |
| Molecular Formula | C14H9NS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 6H-indeno[4,5-g][1,3]benzothiazole |
| SMILES | C1=Cc2c(ccc3c2ccc2ncsc23)C1 |
| InChI | InChI=1S/C14H9NS/c1-2-9-4-5-12-11(10(9)3-1)6-7-13-14(12)16-8-15-13/h1,3-8H,2H2 |
| InChIKey | OXYQGSWJBCSPEE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6H-indeno[4,5-g][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-indeno[4,5-g][1,3]benzothiazole?
The IUPAC name of 6H-indeno[4,5-g][1,3]benzothiazole (CID 57375463) is 6H-indeno[4,5-g][1,3]benzothiazole.
What is the SMILES notation for 6H-indeno[4,5-g][1,3]benzothiazole?
The canonical SMILES for 6H-indeno[4,5-g][1,3]benzothiazole is C1=Cc2c(ccc3c2ccc2ncsc23)C1.
What is the InChIKey of 6H-indeno[4,5-g][1,3]benzothiazole?
The InChIKey is OXYQGSWJBCSPEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NS/c1-2-9-4-5-12-11(10(9)3-1)6-7-13-14(12)16-8-15-13/h1,3-8H,2H2.
What are the key properties of 6H-indeno[4,5-g][1,3]benzothiazole?
6H-indeno[4,5-g][1,3]benzothiazole has a molecular weight of 223.30 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-indeno[4,5-g][1,3]benzothiazole is sourced from PubChem (CID 57375463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).