About (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate
(2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate (PubChem CID 57375646) has the molecular formula C6H4F4O3
and a molecular weight of 200.09 g/mol. Its IUPAC name is (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate.
Molecular Properties
| Compound Name | (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate |
| PubChem CID | 57375646 |
| Molecular Formula | C6H4F4O3 |
| Molecular Weight | 200.09 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate |
| SMILES | FOc1ccc(F)c(OF)c1F.O |
| InChI | InChI=1S/C6H2F4O2.H2O/c7-3-1-2-4(11-9)5(8)6(3)12-10;/h1-2H;1H2 |
| InChIKey | SNUUHOPSMFPFTL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 49.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.09 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate?
The IUPAC name of (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate (CID 57375646) is (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate.
What is the SMILES notation for (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate?
The canonical SMILES for (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate is FOc1ccc(F)c(OF)c1F.O.
What is the InChIKey of (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate?
The InChIKey is SNUUHOPSMFPFTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F4O2.H2O/c7-3-1-2-4(11-9)5(8)6(3)12-10;/h1-2H;1H2.
What are the key properties of (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate?
(2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate has a molecular weight of 200.09 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluoro-3-fluorooxyphenyl) hypofluorite;hydrate is sourced from PubChem (CID 57375646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).