About furo[2,3-e][1,2]benzoxazole
furo[2,3-e][1,2]benzoxazole (PubChem CID 57375713) has the molecular formula C9H5NO2
and a molecular weight of 159.14 g/mol. Its IUPAC name is furo[2,3-e][1,2]benzoxazole.
Molecular Properties
| Compound Name | furo[2,3-e][1,2]benzoxazole |
| PubChem CID | 57375713 |
| Molecular Formula | C9H5NO2 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.03 |
| IUPAC Name | furo[2,3-e][1,2]benzoxazole |
| SMILES | c1cc2ccc3oncc3c2o1 |
| InChI | InChI=1S/C9H5NO2/c1-2-8-7(5-10-12-8)9-6(1)3-4-11-9/h1-5H |
| InChIKey | RMSXXPDDXINLRM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[2,3-e][1,2]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[2,3-e][1,2]benzoxazole?
The IUPAC name of furo[2,3-e][1,2]benzoxazole (CID 57375713) is furo[2,3-e][1,2]benzoxazole.
What is the SMILES notation for furo[2,3-e][1,2]benzoxazole?
The canonical SMILES for furo[2,3-e][1,2]benzoxazole is c1cc2ccc3oncc3c2o1.
What is the InChIKey of furo[2,3-e][1,2]benzoxazole?
The InChIKey is RMSXXPDDXINLRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO2/c1-2-8-7(5-10-12-8)9-6(1)3-4-11-9/h1-5H.
What are the key properties of furo[2,3-e][1,2]benzoxazole?
furo[2,3-e][1,2]benzoxazole has a molecular weight of 159.14 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[2,3-e][1,2]benzoxazole is sourced from PubChem (CID 57375713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).