C20H22N12Na2O6S2 — CID 57376498
disodium;5,5-bis[(4,6-diamino-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate (PubChem CID 57376498) has the molecular formula C20H22N12Na2O6S2 and a molecular weight of 636.59 g/mol. Its IUPAC name is disodium;5,5-bis[(4,6-diamino-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate.
| Compound Name | disodium;5,5-bis[(4,6-diamino-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate |
|---|---|
| PubChem CID | 57376498 |
| Molecular Formula | C20H22N12Na2O6S2 |
| Molecular Weight | 636.59 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | disodium;5,5-bis[(4,6-diamino-1,3,5-triazin-2-yl)amino]-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonate |
| SMILES | Nc1nc(N)nc(NC2(Nc3nc(N)nc(N)n3)C=CC(C=Cc3ccccc3)C(S(=O)(=O)[O-])(S(=O)(=O)[O-])C2)n1.[Na+].[Na+] |
| InChI | InChI=1S/C20H24N12O6S2.2Na/c21-13-25-14(22)28-17(27-13)31-19(32-18-29-15(23)26-16(24)30-18)9-8-12(7-6-11-4-2-1-3-5-11)20(10-19,39(33,34)35)40(36,37)38;;/h1-9,12H,10H2,(H,33,34,35)(H,36,37,38)(H5,21,22,25,27,28,31)(H5,23,24,26,29,30,32);;/q;2*+1/p-2 |
| InChIKey | JIPMEYVAAAXXPJ-UHFFFAOYSA-L |
| XLogP | -7.31 |
| TPSA | 319.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.59 |
| LogP ≤ 5 | -7.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|