About 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran
6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran (PubChem CID 57376774) has the molecular formula C24H20O2
and a molecular weight of 340.42 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran.
Molecular Properties
| Compound Name | 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran |
| PubChem CID | 57376774 |
| Molecular Formula | C24H20O2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran |
| SMILES | COc1ccc(C2=CC(c3ccccc3)=CC(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C24H20O2/c1-25-22-14-12-20(13-15-22)24-17-21(18-8-4-2-5-9-18)16-23(26-24)19-10-6-3-7-11-19/h2-17,23H,1H3 |
| InChIKey | LBODYEHFPUGVGP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran?
The IUPAC name of 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran (CID 57376774) is 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran.
What is the SMILES notation for 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran?
The canonical SMILES for 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran is COc1ccc(C2=CC(c3ccccc3)=CC(c3ccccc3)O2)cc1.
What is the InChIKey of 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran?
The InChIKey is LBODYEHFPUGVGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O2/c1-25-22-14-12-20(13-15-22)24-17-21(18-8-4-2-5-9-18)16-23(26-24)19-10-6-3-7-11-19/h2-17,23H,1H3.
What are the key properties of 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran?
6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran has a molecular weight of 340.42 g/mol, XLogP of 5.89, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methoxyphenyl)-2,4-diphenyl-2H-pyran is sourced from PubChem (CID 57376774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).