About [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol
[(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol (PubChem CID 57377167) has the molecular formula C13H18FNO
and a molecular weight of 223.29 g/mol. Its IUPAC name is [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol |
| PubChem CID | 57377167 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol |
| SMILES | CN1CC[C@@H](c2ccccc2F)[C@H](CO)C1 |
| InChI | InChI=1S/C13H18FNO/c1-15-7-6-11(10(8-15)9-16)12-4-2-3-5-13(12)14/h2-5,10-11,16H,6-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | MTPBJZJBULTHST-WDEREUQCSA-N |
| XLogP | 1.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol?
The IUPAC name of [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol (CID 57377167) is [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol.
What is the SMILES notation for [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol?
The canonical SMILES for [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol is CN1CC[C@@H](c2ccccc2F)[C@H](CO)C1.
What is the InChIKey of [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol?
The InChIKey is MTPBJZJBULTHST-WDEREUQCSA-N. The full InChI is InChI=1S/C13H18FNO/c1-15-7-6-11(10(8-15)9-16)12-4-2-3-5-13(12)14/h2-5,10-11,16H,6-9H2,1H3/t10-,11+/m0/s1.
What are the key properties of [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol?
[(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol has a molecular weight of 223.29 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-(2-fluorophenyl)-1-methylpiperidin-3-yl]methanol is sourced from PubChem (CID 57377167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).