C16H16N4O2SSe — CID 57377417
4-(5,6,7,8-tetrahydro-[1]benzoselenolo[2,3-d]pyrimidin-4-ylamino)benzenesulfonamide (PubChem CID 57377417) has the molecular formula C16H16N4O2SSe and a molecular weight of 407.36 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydro-[1]benzoselenolo[2,3-d]pyrimidin-4-ylamino)benzenesulfonamide.
| Compound Name | 4-(5,6,7,8-tetrahydro-[1]benzoselenolo[2,3-d]pyrimidin-4-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 57377417 |
| Molecular Formula | C16H16N4O2SSe |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 4-(5,6,7,8-tetrahydro-[1]benzoselenolo[2,3-d]pyrimidin-4-ylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ncnc3[se]c4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C16H16N4O2SSe/c17-23(21,22)11-7-5-10(6-8-11)20-15-14-12-3-1-2-4-13(12)24-16(14)19-9-18-15/h5-9H,1-4H2,(H2,17,21,22)(H,18,19,20) |
| InChIKey | AVIDRFCZOAAHNJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|