About 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one
3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one (PubChem CID 57377707) has the molecular formula C21H20N2O5S2
and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one.
Molecular Properties
| Compound Name | 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one |
| PubChem CID | 57377707 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one |
| SMILES | O=C(c1ccccc1)C1C(=O)c2ccccc2S(=O)(=O)N1CC(=O)N1CCSCC1 |
| InChI | InChI=1S/C21H20N2O5S2/c24-18(22-10-12-29-13-11-22)14-23-19(20(25)15-6-2-1-3-7-15)21(26)16-8-4-5-9-17(16)30(23,27)28/h1-9,19H,10-14H2 |
| InChIKey | VNDBKZVCDVXMNI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one?
The IUPAC name of 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one (CID 57377707) is 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one.
What is the SMILES notation for 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one?
The canonical SMILES for 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one is O=C(c1ccccc1)C1C(=O)c2ccccc2S(=O)(=O)N1CC(=O)N1CCSCC1.
What is the InChIKey of 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one?
The InChIKey is VNDBKZVCDVXMNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O5S2/c24-18(22-10-12-29-13-11-22)14-23-19(20(25)15-6-2-1-3-7-15)21(26)16-8-4-5-9-17(16)30(23,27)28/h1-9,19H,10-14H2.
What are the key properties of 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one?
3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one has a molecular weight of 444.53 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoyl-1,1-dioxo-2-(2-oxo-2-thiomorpholin-4-ylethyl)-3H-1λ6,2-benzothiazin-4-one is sourced from PubChem (CID 57377707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).