C28H17ClF3N7O2 — CID 57378081
4-[5-[4-[4-(2-chlorophenyl)-5-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]but-2-ynyl]-1,3,4-oxadiazol-2-yl]benzonitrile (PubChem CID 57378081) has the molecular formula C28H17ClF3N7O2 and a molecular weight of 575.94 g/mol. Its IUPAC name is 4-[5-[4-[4-(2-chlorophenyl)-5-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]but-2-ynyl]-1,3,4-oxadiazol-2-yl]benzonitrile.
| Compound Name | 4-[5-[4-[4-(2-chlorophenyl)-5-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]but-2-ynyl]-1,3,4-oxadiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 57378081 |
| Molecular Formula | C28H17ClF3N7O2 |
| Molecular Weight | 575.94 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | 4-[5-[4-[4-(2-chlorophenyl)-5-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]-1,2,4-triazol-3-yl]but-2-ynyl]-1,3,4-oxadiazol-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nnc(CC#CCc3nnc(-c4ccc(OCC(F)(F)F)cn4)n3-c3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C28H17ClF3N7O2/c29-21-5-1-2-6-23(21)39-24(35-37-26(39)22-14-13-20(16-34-22)40-17-28(30,31)32)7-3-4-8-25-36-38-27(41-25)19-11-9-18(15-33)10-12-19/h1-2,5-6,9-14,16H,7-8,17H2 |
| InChIKey | YNCICPJSVXUXJZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 115.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.94 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|