About N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide
N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide (PubChem CID 57378276) has the molecular formula C21H16F3N3O3S
and a molecular weight of 447.44 g/mol. Its IUPAC name is N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide |
| PubChem CID | 57378276 |
| Molecular Formula | C21H16F3N3O3S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1)N(Cc1ccc(OC(F)(F)F)cc1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C21H16F3N3O3S/c22-21(23,24)30-17-11-9-16(10-12-17)14-27(31(28,29)18-6-2-1-3-7-18)20-15-26-13-5-4-8-19(26)25-20/h1-13,15H,14H2 |
| InChIKey | WFXBIQGMVFJHIM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide?
The IUPAC name of N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide (CID 57378276) is N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide.
What is the SMILES notation for N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide?
The canonical SMILES for N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide is O=S(=O)(c1ccccc1)N(Cc1ccc(OC(F)(F)F)cc1)c1cn2ccccc2n1.
What is the InChIKey of N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide?
The InChIKey is WFXBIQGMVFJHIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3N3O3S/c22-21(23,24)30-17-11-9-16(10-12-17)14-27(31(28,29)18-6-2-1-3-7-18)20-15-26-13-5-4-8-19(26)25-20/h1-13,15H,14H2.
What are the key properties of N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide?
N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide has a molecular weight of 447.44 g/mol, XLogP of 4.63, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-imidazo[1,2-a]pyridin-2-yl-N-[[4-(trifluoromethoxy)phenyl]methyl]benzenesulfonamide is sourced from PubChem (CID 57378276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).