About S-benzamido cyclopentanecarbothioate
S-benzamido cyclopentanecarbothioate (PubChem CID 57378449) has the molecular formula C13H15NO2S
and a molecular weight of 249.33 g/mol. Its IUPAC name is S-benzamido cyclopentanecarbothioate.
Molecular Properties
| Compound Name | S-benzamido cyclopentanecarbothioate |
| PubChem CID | 57378449 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | S-benzamido cyclopentanecarbothioate |
| SMILES | O=C(NSC(=O)C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C13H15NO2S/c15-12(10-6-2-1-3-7-10)14-17-13(16)11-8-4-5-9-11/h1-3,6-7,11H,4-5,8-9H2,(H,14,15) |
| InChIKey | YWQLOUWWUAYRAU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzamido cyclopentanecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzamido cyclopentanecarbothioate?
The IUPAC name of S-benzamido cyclopentanecarbothioate (CID 57378449) is S-benzamido cyclopentanecarbothioate.
What is the SMILES notation for S-benzamido cyclopentanecarbothioate?
The canonical SMILES for S-benzamido cyclopentanecarbothioate is O=C(NSC(=O)C1CCCC1)c1ccccc1.
What is the InChIKey of S-benzamido cyclopentanecarbothioate?
The InChIKey is YWQLOUWWUAYRAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2S/c15-12(10-6-2-1-3-7-10)14-17-13(16)11-8-4-5-9-11/h1-3,6-7,11H,4-5,8-9H2,(H,14,15).
What are the key properties of S-benzamido cyclopentanecarbothioate?
S-benzamido cyclopentanecarbothioate has a molecular weight of 249.33 g/mol, XLogP of 2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzamido cyclopentanecarbothioate is sourced from PubChem (CID 57378449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).