About 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol
2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol (PubChem CID 57378636) has the molecular formula C26H22N4O
and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol.
Molecular Properties
| Compound Name | 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol |
| PubChem CID | 57378636 |
| Molecular Formula | C26H22N4O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol |
| SMILES | NC1(c2ccc(-c3nc4c5cccc(O)c5nn4cc3-c3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C26H22N4O/c27-26(14-5-15-26)19-12-10-18(11-13-19)23-21(17-6-2-1-3-7-17)16-30-25(28-23)20-8-4-9-22(31)24(20)29-30/h1-4,6-13,16,31H,5,14-15,27H2 |
| InChIKey | SXIOPKJMHPTNBI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol?
The IUPAC name of 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol (CID 57378636) is 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol.
What is the SMILES notation for 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol?
The canonical SMILES for 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol is NC1(c2ccc(-c3nc4c5cccc(O)c5nn4cc3-c3ccccc3)cc2)CCC1.
What is the InChIKey of 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol?
The InChIKey is SXIOPKJMHPTNBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N4O/c27-26(14-5-15-26)19-12-10-18(11-13-19)23-21(17-6-2-1-3-7-17)16-30-25(28-23)20-8-4-9-22(31)24(20)29-30/h1-4,6-13,16,31H,5,14-15,27H2.
What are the key properties of 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol?
2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol has a molecular weight of 406.49 g/mol, XLogP of 5.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-aminocyclobutyl)phenyl]-3-phenylpyrimido[1,2-b]indazol-7-ol is sourced from PubChem (CID 57378636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).