C24H26FN7O4 — CID 57378731
5-N-[2-[3-(2-fluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-4-N-(2-methoxyethyl)-4-N,1-dimethylpyrazole-4,5-dicarboxamide (PubChem CID 57378731) has the molecular formula C24H26FN7O4 and a molecular weight of 495.52 g/mol. Its IUPAC name is 5-N-[2-[3-(2-fluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-4-N-(2-methoxyethyl)-4-N,1-dimethylpyrazole-4,5-dicarboxamide.
| Compound Name | 5-N-[2-[3-(2-fluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-4-N-(2-methoxyethyl)-4-N,1-dimethylpyrazole-4,5-dicarboxamide |
|---|---|
| PubChem CID | 57378731 |
| Molecular Formula | C24H26FN7O4 |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 5-N-[2-[3-(2-fluoroethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-4-N-(2-methoxyethyl)-4-N,1-dimethylpyrazole-4,5-dicarboxamide |
| SMILES | COCCN(C)C(=O)c1cnn(C)c1C(=O)Nc1ccn2nc(-c3cccc(OCCF)c3)nc2c1 |
| InChI | InChI=1S/C24H26FN7O4/c1-30(10-12-35-3)24(34)19-15-26-31(2)21(19)23(33)27-17-7-9-32-20(14-17)28-22(29-32)16-5-4-6-18(13-16)36-11-8-25/h4-7,9,13-15H,8,10-12H2,1-3H3,(H,27,33) |
| InChIKey | VNVDSKDANPTRIS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |