About 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone
2-bromo-1-(3,3-dinitrocyclopentyl)ethanone (PubChem CID 57378826) has the molecular formula C7H9BrN2O5
and a molecular weight of 281.06 g/mol. Its IUPAC name is 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone |
| PubChem CID | 57378826 |
| Molecular Formula | C7H9BrN2O5 |
| Molecular Weight | 281.06 g/mol |
| Exact Mass | 279.97 |
| IUPAC Name | 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone |
| SMILES | O=C(CBr)C1CCC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C7H9BrN2O5/c8-4-6(11)5-1-2-7(3-5,9(12)13)10(14)15/h5H,1-4H2 |
| InChIKey | FZZQEBIQYCPKHH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.06 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone?
The IUPAC name of 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone (CID 57378826) is 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone.
What is the SMILES notation for 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone?
The canonical SMILES for 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone is O=C(CBr)C1CCC([N+](=O)[O-])([N+](=O)[O-])C1.
What is the InChIKey of 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone?
The InChIKey is FZZQEBIQYCPKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O5/c8-4-6(11)5-1-2-7(3-5,9(12)13)10(14)15/h5H,1-4H2.
What are the key properties of 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone?
2-bromo-1-(3,3-dinitrocyclopentyl)ethanone has a molecular weight of 281.06 g/mol, XLogP of 1.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(3,3-dinitrocyclopentyl)ethanone is sourced from PubChem (CID 57378826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).