C16H20F6N2O — CID 57379021
N-ethyl-N'-[4-(2,2,3,4,4,4-hexafluorobutoxy)-2,5-dimethylphenyl]-N-methylmethanimidamide (PubChem CID 57379021) has the molecular formula C16H20F6N2O and a molecular weight of 370.34 g/mol. Its IUPAC name is N-ethyl-N'-[4-(2,2,3,4,4,4-hexafluorobutoxy)-2,5-dimethylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[4-(2,2,3,4,4,4-hexafluorobutoxy)-2,5-dimethylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 57379021 |
| Molecular Formula | C16H20F6N2O |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-ethyl-N'-[4-(2,2,3,4,4,4-hexafluorobutoxy)-2,5-dimethylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(OCC(F)(F)C(F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C16H20F6N2O/c1-5-24(4)9-23-12-6-11(3)13(7-10(12)2)25-8-15(18,19)14(17)16(20,21)22/h6-7,9,14H,5,8H2,1-4H3/b23-9+ |
| InChIKey | QXZYAKJZKLLBIT-NUGSKGIGSA-N |
| XLogP | 4.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|