C25H20BrNO2 — CID 57379164
(3'S,5'S)-5-bromo-3',5'-diphenylspiro[1H-indole-3,4'-cyclohexane]-1',2-dione (PubChem CID 57379164) has the molecular formula C25H20BrNO2 and a molecular weight of 446.34 g/mol. Its IUPAC name is (3'S,5'S)-5-bromo-3',5'-diphenylspiro[1H-indole-3,4'-cyclohexane]-1',2-dione.
| Compound Name | (3'S,5'S)-5-bromo-3',5'-diphenylspiro[1H-indole-3,4'-cyclohexane]-1',2-dione |
|---|---|
| PubChem CID | 57379164 |
| Molecular Formula | C25H20BrNO2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | (3'S,5'S)-5-bromo-3',5'-diphenylspiro[1H-indole-3,4'-cyclohexane]-1',2-dione |
| SMILES | O=C1C[C@@H](c2ccccc2)C2(C(=O)Nc3ccc(Br)cc32)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C25H20BrNO2/c26-18-11-12-23-22(13-18)25(24(29)27-23)20(16-7-3-1-4-8-16)14-19(28)15-21(25)17-9-5-2-6-10-17/h1-13,20-21H,14-15H2,(H,27,29)/t20-,21-/m0/s1 |
| InChIKey | PRWATYVTMCWKGD-SFTDATJTSA-N |
| XLogP | 5.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |