C30H28P2 — CID 57379171
[(2R,3R,5S)-5-(diphenylphosphanylmethyl)spiro[2.2]pentan-2-yl]-diphenylphosphane (PubChem CID 57379171) has the molecular formula C30H28P2 and a molecular weight of 450.50 g/mol. Its IUPAC name is [(2R,3R,5S)-5-(diphenylphosphanylmethyl)spiro[2.2]pentan-2-yl]-diphenylphosphane.
| Compound Name | [(2R,3R,5S)-5-(diphenylphosphanylmethyl)spiro[2.2]pentan-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 57379171 |
| Molecular Formula | C30H28P2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [(2R,3R,5S)-5-(diphenylphosphanylmethyl)spiro[2.2]pentan-2-yl]-diphenylphosphane |
| SMILES | c1ccc(P(C[C@H]2C[C@@]23C[C@H]3P(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28P2/c1-5-13-25(14-6-1)31(26-15-7-2-8-16-26)23-24-21-30(24)22-29(30)32(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,24,29H,21-23H2/t24-,29-,30-/m1/s1 |
| InChIKey | UDGDNCCWPUNALI-HGLPBTONSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|