C11H16O3 — CID 57379198
(2E,5E)-4-hydroxy-2-propylideneocta-5,7-dienoic acid (PubChem CID 57379198) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2E,5E)-4-hydroxy-2-propylideneocta-5,7-dienoic acid.
| Compound Name | (2E,5E)-4-hydroxy-2-propylideneocta-5,7-dienoic acid |
|---|---|
| PubChem CID | 57379198 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2E,5E)-4-hydroxy-2-propylideneocta-5,7-dienoic acid |
| SMILES | C=C/C=C/C(O)C/C(=C\CC)C(=O)O |
| InChI | InChI=1S/C11H16O3/c1-3-5-7-10(12)8-9(6-4-2)11(13)14/h3,5-7,10,12H,1,4,8H2,2H3,(H,13,14)/b7-5+,9-6+ |
| InChIKey | SSSYMZDZKBTBDM-PDTNFJSOSA-N |
| XLogP | 1.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|