About 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol
12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol (PubChem CID 57379200) has the molecular formula C18H31NO3
and a molecular weight of 309.45 g/mol. Its IUPAC name is 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol.
Molecular Properties
| Compound Name | 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol |
| PubChem CID | 57379200 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol |
| SMILES | Cc1nc(CCCCCCCC(O)CCCCO)ccc1O |
| InChI | InChI=1S/C18H31NO3/c1-15-18(22)13-12-16(19-15)9-5-3-2-4-6-10-17(21)11-7-8-14-20/h12-13,17,20-22H,2-11,14H2,1H3 |
| InChIKey | RLBAFDJXAXIJCH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol?
The IUPAC name of 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol (CID 57379200) is 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol.
What is the SMILES notation for 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol?
The canonical SMILES for 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol is Cc1nc(CCCCCCCC(O)CCCCO)ccc1O.
What is the InChIKey of 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol?
The InChIKey is RLBAFDJXAXIJCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31NO3/c1-15-18(22)13-12-16(19-15)9-5-3-2-4-6-10-17(21)11-7-8-14-20/h12-13,17,20-22H,2-11,14H2,1H3.
What are the key properties of 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol?
12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol has a molecular weight of 309.45 g/mol, XLogP of 3.50, 12 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(5-hydroxy-6-methyl-2-pyridinyl)dodecane-1,5-diol is sourced from PubChem (CID 57379200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).