C31H25BF2N2O6 — CID 57379433
diethyl 12,12-difluoro-2-(4-methoxycarbonylphenyl)-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4,6,8,10,14,16,18-nonaene-10,14-dicarboxylate (PubChem CID 57379433) has the molecular formula C31H25BF2N2O6 and a molecular weight of 570.36 g/mol. Its IUPAC name is diethyl 12,12-difluoro-2-(4-methoxycarbonylphenyl)-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4,6,8,10,14,16,18-nonaene-10,14-dicarboxylate.
| Compound Name | diethyl 12,12-difluoro-2-(4-methoxycarbonylphenyl)-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4,6,8,10,14,16,18-nonaene-10,14-dicarboxylate |
|---|---|
| PubChem CID | 57379433 |
| Molecular Formula | C31H25BF2N2O6 |
| Molecular Weight | 570.36 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | diethyl 12,12-difluoro-2-(4-methoxycarbonylphenyl)-13-aza-11-azonia-12-boranuidapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1(20),2,4,6,8,10,14,16,18-nonaene-10,14-dicarboxylate |
| SMILES | CCOC(=O)C1=[N+]2C(=C(c3ccc(C(=O)OC)cc3)c3c4ccccc4c(C(=O)OCC)n3[B-]2(F)F)c2ccccc21 |
| InChI | InChI=1S/C31H25BF2N2O6/c1-4-41-30(38)27-22-12-8-6-10-20(22)25-24(18-14-16-19(17-15-18)29(37)40-3)26-21-11-7-9-13-23(21)28(31(39)42-5-2)36(26)32(33,34)35(25)27/h6-17H,4-5H2,1-3H3 |
| InChIKey | CIUKQWCKIPCGGF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 86.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.36 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|