About (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate
(2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate (PubChem CID 57379485) has the molecular formula C24H20N2O2
and a molecular weight of 368.44 g/mol. Its IUPAC name is (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate.
Molecular Properties
| Compound Name | (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate |
| PubChem CID | 57379485 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate |
| SMILES | O=C(OC(Cn1ccnc1)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O2/c27-24(22-13-11-20(12-14-22)19-7-3-1-4-8-19)28-23(17-26-16-15-25-18-26)21-9-5-2-6-10-21/h1-16,18,23H,17H2 |
| InChIKey | RYYLZOUXUDQNJZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate?
The IUPAC name of (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate (CID 57379485) is (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate.
What is the SMILES notation for (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate?
The canonical SMILES for (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate is O=C(OC(Cn1ccnc1)c1ccccc1)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate?
The InChIKey is RYYLZOUXUDQNJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O2/c27-24(22-13-11-20(12-14-22)19-7-3-1-4-8-19)28-23(17-26-16-15-25-18-26)21-9-5-2-6-10-21/h1-16,18,23H,17H2.
What are the key properties of (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate?
(2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate has a molecular weight of 368.44 g/mol, XLogP of 5.15, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-imidazol-1-yl-1-phenylethyl) 4-phenylbenzoate is sourced from PubChem (CID 57379485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).