About 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole
9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole (PubChem CID 57379520) has the molecular formula C30H21NS4
and a molecular weight of 523.77 g/mol. Its IUPAC name is 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole.
Molecular Properties
| Compound Name | 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole |
| PubChem CID | 57379520 |
| Molecular Formula | C30H21NS4 |
| Molecular Weight | 523.77 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole |
| SMILES | CCn1c2ccc(-c3ccc(-c4cccs4)s3)cc2c2cc(-c3ccc(-c4cccs4)s3)ccc21 |
| InChI | InChI=1S/C30H21NS4/c1-2-31-23-9-7-19(25-11-13-29(34-25)27-5-3-15-32-27)17-21(23)22-18-20(8-10-24(22)31)26-12-14-30(35-26)28-6-4-16-33-28/h3-18H,2H2,1H3 |
| InChIKey | MMRAPQANLFWTGO-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.77 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole?
The IUPAC name of 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole (CID 57379520) is 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole.
What is the SMILES notation for 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole?
The canonical SMILES for 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole is CCn1c2ccc(-c3ccc(-c4cccs4)s3)cc2c2cc(-c3ccc(-c4cccs4)s3)ccc21.
What is the InChIKey of 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole?
The InChIKey is MMRAPQANLFWTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21NS4/c1-2-31-23-9-7-19(25-11-13-29(34-25)27-5-3-15-32-27)17-21(23)22-18-20(8-10-24(22)31)26-12-14-30(35-26)28-6-4-16-33-28/h3-18H,2H2,1H3.
What are the key properties of 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole?
9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole has a molecular weight of 523.77 g/mol, XLogP of 10.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-3,6-bis(5-thiophen-2-ylthiophen-2-yl)carbazole is sourced from PubChem (CID 57379520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).