About (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate
(2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate (PubChem CID 57379731) has the molecular formula C13H11F3N2O3S
and a molecular weight of 332.30 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate.
Molecular Properties
| Compound Name | (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate |
| PubChem CID | 57379731 |
| Molecular Formula | C13H11F3N2O3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate |
| SMILES | Nc1nc(COC(=O)Cc2ccccc2OC(F)(F)F)cs1 |
| InChI | InChI=1S/C13H11F3N2O3S/c14-13(15,16)21-10-4-2-1-3-8(10)5-11(19)20-6-9-7-22-12(17)18-9/h1-4,7H,5-6H2,(H2,17,18) |
| InChIKey | UDSGZUIPQUMKGY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate?
The IUPAC name of (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate (CID 57379731) is (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate.
What is the SMILES notation for (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate?
The canonical SMILES for (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate is Nc1nc(COC(=O)Cc2ccccc2OC(F)(F)F)cs1.
What is the InChIKey of (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate?
The InChIKey is UDSGZUIPQUMKGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3N2O3S/c14-13(15,16)21-10-4-2-1-3-8(10)5-11(19)20-6-9-7-22-12(17)18-9/h1-4,7H,5-6H2,(H2,17,18).
What are the key properties of (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate?
(2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate has a molecular weight of 332.30 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-thiazol-4-yl)methyl 2-[2-(trifluoromethoxy)phenyl]acetate is sourced from PubChem (CID 57379731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).