C11H24O3Si — CID 57379881
(2S,3R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-ene-2,3-diol (PubChem CID 57379881) has the molecular formula C11H24O3Si and a molecular weight of 232.40 g/mol. Its IUPAC name is (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-ene-2,3-diol.
| Compound Name | (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-ene-2,3-diol |
|---|---|
| PubChem CID | 57379881 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (2S,3R)-1-[tert-butyl(dimethyl)silyl]oxypent-4-ene-2,3-diol |
| SMILES | C=C[C@@H](O)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H24O3Si/c1-7-9(12)10(13)8-14-15(5,6)11(2,3)4/h7,9-10,12-13H,1,8H2,2-6H3/t9-,10+/m1/s1 |
| InChIKey | QELQURCNZNUZRO-ZJUUUORDSA-N |
| XLogP | 1.92 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|