About (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate
(2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate (PubChem CID 57379966) has the molecular formula C9H8N2O3S
and a molecular weight of 224.24 g/mol. Its IUPAC name is (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate.
Molecular Properties
| Compound Name | (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate |
| PubChem CID | 57379966 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate |
| SMILES | Nc1nc(COC(=O)c2ccco2)cs1 |
| InChI | InChI=1S/C9H8N2O3S/c10-9-11-6(5-15-9)4-14-8(12)7-2-1-3-13-7/h1-3,5H,4H2,(H2,10,11) |
| InChIKey | HECBKFYCDMNQAM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate?
The IUPAC name of (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate (CID 57379966) is (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate.
What is the SMILES notation for (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate?
The canonical SMILES for (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate is Nc1nc(COC(=O)c2ccco2)cs1.
What is the InChIKey of (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate?
The InChIKey is HECBKFYCDMNQAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S/c10-9-11-6(5-15-9)4-14-8(12)7-2-1-3-13-7/h1-3,5H,4H2,(H2,10,11).
What are the key properties of (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate?
(2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate has a molecular weight of 224.24 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-thiazol-4-yl)methyl furan-2-carboxylate is sourced from PubChem (CID 57379966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).