About CID 57380020
CID 57380020 (PubChem CID 57380020) has the molecular formula C39H32N3P2
and a molecular weight of 604.65 g/mol.
Molecular Properties
| Compound Name | CID 57380020 |
| PubChem CID | 57380020 |
| Molecular Formula | C39H32N3P2 |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | — |
| SMILES | C[C@H]([C]1[CH][CH][CH][C]1n1nnc(-c2ccccc2)c1P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H32N3P2/c1-30(43(32-20-9-3-10-21-32)33-22-11-4-12-23-33)36-28-17-29-37(36)42-39(38(40-41-42)31-18-7-2-8-19-31)44(34-24-13-5-14-25-34)35-26-15-6-16-27-35/h2-30H,1H3/t30-/m1/s1 |
| InChIKey | INLDRLCEYNSKHX-SSEXGKCCSA-N |
| XLogP | 6.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 57380020 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57380020?
The IUPAC name of CID 57380020 (CID 57380020) is not available.
What is the SMILES notation for CID 57380020?
The canonical SMILES for CID 57380020 is C[C@H]([C]1[CH][CH][CH][C]1n1nnc(-c2ccccc2)c1P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 57380020?
The InChIKey is INLDRLCEYNSKHX-SSEXGKCCSA-N. The full InChI is InChI=1S/C39H32N3P2/c1-30(43(32-20-9-3-10-21-32)33-22-11-4-12-23-33)36-28-17-29-37(36)42-39(38(40-41-42)31-18-7-2-8-19-31)44(34-24-13-5-14-25-34)35-26-15-6-16-27-35/h2-30H,1H3/t30-/m1/s1.
What are the key properties of CID 57380020?
CID 57380020 has a molecular weight of 604.65 g/mol, XLogP of 6.81, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57380020 is sourced from PubChem (CID 57380020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).