C9H13F3N2O4S — CID 57380062
(3aR,5S,6S,7R,7aR)-2-(methylamino)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 57380062) has the molecular formula C9H13F3N2O4S and a molecular weight of 302.27 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-2-(methylamino)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5S,6S,7R,7aR)-2-(methylamino)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 57380062 |
| Molecular Formula | C9H13F3N2O4S |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-2-(methylamino)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CNC1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](C(O)C(F)(F)F)O[C@@H]2S1 |
| InChI | InChI=1S/C9H13F3N2O4S/c1-13-8-14-2-3(15)4(16)5(18-7(2)19-8)6(17)9(10,11)12/h2-7,15-17H,1H3,(H,13,14)/t2-,3-,4+,5+,6?,7-/m1/s1 |
| InChIKey | LTRYFIQEOFIFTG-JPJJNFHFSA-N |
| XLogP | -0.95 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |