About 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole
3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole (PubChem CID 57380254) has the molecular formula C18H16N4
and a molecular weight of 288.35 g/mol. Its IUPAC name is 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole.
Molecular Properties
| Compound Name | 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole |
| PubChem CID | 57380254 |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole |
| SMILES | Cc1nn(-c2ccccc2)c2nc(-c3ccccc3)n(C)c12 |
| InChI | InChI=1S/C18H16N4/c1-13-16-18(22(20-13)15-11-7-4-8-12-15)19-17(21(16)2)14-9-5-3-6-10-14/h3-12H,1-2H3 |
| InChIKey | RQZMYKRBFRKKGJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole?
The IUPAC name of 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole (CID 57380254) is 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole.
What is the SMILES notation for 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole?
The canonical SMILES for 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole is Cc1nn(-c2ccccc2)c2nc(-c3ccccc3)n(C)c12.
What is the InChIKey of 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole?
The InChIKey is RQZMYKRBFRKKGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4/c1-13-16-18(22(20-13)15-11-7-4-8-12-15)19-17(21(16)2)14-9-5-3-6-10-14/h3-12H,1-2H3.
What are the key properties of 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole?
3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole has a molecular weight of 288.35 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1,5-diphenylimidazo[4,5-d]pyrazole is sourced from PubChem (CID 57380254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).