C11H8Cl2N4O2 — CID 57380287
2-(3,5-dichloroanilino)-N-hydroxypyrimidine-5-carboxamide (PubChem CID 57380287) has the molecular formula C11H8Cl2N4O2 and a molecular weight of 299.12 g/mol. Its IUPAC name is 2-(3,5-dichloroanilino)-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-(3,5-dichloroanilino)-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 57380287 |
| Molecular Formula | C11H8Cl2N4O2 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 2-(3,5-dichloroanilino)-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(Nc2cc(Cl)cc(Cl)c2)nc1 |
| InChI | InChI=1S/C11H8Cl2N4O2/c12-7-1-8(13)3-9(2-7)16-11-14-4-6(5-15-11)10(18)17-19/h1-5,19H,(H,17,18)(H,14,15,16) |
| InChIKey | PSQINXXGYNKFLJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|