About 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide
2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 57380292) has the molecular formula C13H8F6N4O2
and a molecular weight of 366.22 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide |
| PubChem CID | 57380292 |
| Molecular Formula | C13H8F6N4O2 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C13H8F6N4O2/c14-12(15,16)7-1-8(13(17,18)19)3-9(2-7)22-11-20-4-6(5-21-11)10(24)23-25/h1-5,25H,(H,23,24)(H,20,21,22) |
| InChIKey | WMGVCXNZMLJKND-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide (CID 57380292) is 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide is O=C(NO)c1cnc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide?
The InChIKey is WMGVCXNZMLJKND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F6N4O2/c14-12(15,16)7-1-8(13(17,18)19)3-9(2-7)22-11-20-4-6(5-21-11)10(24)23-25/h1-5,25H,(H,23,24)(H,20,21,22).
What are the key properties of 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide?
2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide has a molecular weight of 366.22 g/mol, XLogP of 3.38, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)anilino]-N-hydroxypyrimidine-5-carboxamide is sourced from PubChem (CID 57380292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).