C24H40O3Si — CID 57380350
tert-butyl (1S,2S,9R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyltricyclo[7.2.1.01,7]dodeca-5,7-diene-11-carboxylate (PubChem CID 57380350) has the molecular formula C24H40O3Si and a molecular weight of 404.67 g/mol. Its IUPAC name is tert-butyl (1S,2S,9R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyltricyclo[7.2.1.01,7]dodeca-5,7-diene-11-carboxylate.
| Compound Name | tert-butyl (1S,2S,9R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyltricyclo[7.2.1.01,7]dodeca-5,7-diene-11-carboxylate |
|---|---|
| PubChem CID | 57380350 |
| Molecular Formula | C24H40O3Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | tert-butyl (1S,2S,9R,11S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyltricyclo[7.2.1.01,7]dodeca-5,7-diene-11-carboxylate |
| SMILES | C[C@H]1CCC=CC2=C(O[Si](C)(C)C(C)(C)C)[C@@H]3C[C@H](C(=O)OC(C)(C)C)[C@@]21C3 |
| InChI | InChI=1S/C24H40O3Si/c1-16-12-10-11-13-18-20(27-28(8,9)23(5,6)7)17-14-19(24(16,18)15-17)21(25)26-22(2,3)4/h11,13,16-17,19H,10,12,14-15H2,1-9H3/t16-,17+,19+,24+/m0/s1 |
| InChIKey | VTIBMGYQMOWCCZ-SPMMERNZSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|