C18H18O9 — CID 57380591
[(1S,2R,3S,4R)-1,3,4,8-tetrahydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-2-yl] acetate (PubChem CID 57380591) has the molecular formula C18H18O9 and a molecular weight of 378.33 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-1,3,4,8-tetrahydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-2-yl] acetate.
| Compound Name | [(1S,2R,3S,4R)-1,3,4,8-tetrahydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-2-yl] acetate |
|---|---|
| PubChem CID | 57380591 |
| Molecular Formula | C18H18O9 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [(1S,2R,3S,4R)-1,3,4,8-tetrahydroxy-6-methoxy-3-methyl-9,10-dioxo-2,4-dihydro-1H-anthracen-2-yl] acetate |
| SMILES | COc1cc(O)c2c(c1)C(=O)C1=C(C2=O)[C@H](O)[C@@H](OC(C)=O)[C@@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C18H18O9/c1-6(19)27-17-15(23)11-12(16(24)18(17,2)25)13(21)8-4-7(26-3)5-9(20)10(8)14(11)22/h4-5,15-17,20,23-25H,1-3H3/t15-,16+,17+,18-/m0/s1 |
| InChIKey | JDGCLPKEFXLDSC-MLHJIOFPSA-N |
| XLogP | -0.51 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|