C31H33N2O2P — CID 57381053
[1-[(2R)-oxan-2-yl]-3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]indol-2-yl]-diphenylphosphane (PubChem CID 57381053) has the molecular formula C31H33N2O2P and a molecular weight of 496.59 g/mol. Its IUPAC name is [1-[(2R)-oxan-2-yl]-3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]indol-2-yl]-diphenylphosphane.
| Compound Name | [1-[(2R)-oxan-2-yl]-3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]indol-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 57381053 |
| Molecular Formula | C31H33N2O2P |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | [1-[(2R)-oxan-2-yl]-3-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]indol-2-yl]-diphenylphosphane |
| SMILES | CC(C)[C@H]1COC(c2c(P(c3ccccc3)c3ccccc3)n([C@H]3CCCCO3)c3ccccc23)=N1 |
| InChI | InChI=1S/C31H33N2O2P/c1-22(2)26-21-35-30(32-26)29-25-17-9-10-18-27(25)33(28-19-11-12-20-34-28)31(29)36(23-13-5-3-6-14-23)24-15-7-4-8-16-24/h3-10,13-18,22,26,28H,11-12,19-21H2,1-2H3/t26-,28-/m1/s1 |
| InChIKey | RAZWTYQEYWLBSQ-IXCJQBJRSA-N |
| XLogP | 5.90 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|