C15H13NO3 — CID 57381071
(3S,4S)-3,4-dihydroxy-4-phenyl-1,3-dihydroquinolin-2-one (PubChem CID 57381071) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-4-phenyl-1,3-dihydroquinolin-2-one.
| Compound Name | (3S,4S)-3,4-dihydroxy-4-phenyl-1,3-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 57381071 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-4-phenyl-1,3-dihydroquinolin-2-one |
| SMILES | O=C1Nc2ccccc2[C@@](O)(c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C15H13NO3/c17-13-14(18)16-12-9-5-4-8-11(12)15(13,19)10-6-2-1-3-7-10/h1-9,13,17,19H,(H,16,18)/t13-,15+/m1/s1 |
| InChIKey | ICAOEYXCZNNQNW-HIFRSBDPSA-N |
| XLogP | 1.24 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |