C21H25F3N6O5 — CID 57381074
N-[2-[2-[2-[[3-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methoxy]ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 57381074) has the molecular formula C21H25F3N6O5 and a molecular weight of 498.46 g/mol. Its IUPAC name is N-[2-[2-[2-[[3-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methoxy]ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[2-[2-[[3-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methoxy]ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 57381074 |
| Molecular Formula | C21H25F3N6O5 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | N-[2-[2-[2-[[3-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methoxy]ethoxy]ethoxy]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1nc(OCc2cccc(COCCOCCOCCNC(=O)C(F)(F)F)c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C21H25F3N6O5/c22-21(23,24)19(31)26-4-5-32-6-7-33-8-9-34-11-14-2-1-3-15(10-14)12-35-18-16-17(28-13-27-16)29-20(25)30-18/h1-3,10,13H,4-9,11-12H2,(H,26,31)(H3,25,27,28,29,30) |
| InChIKey | OZNOTLIFAUXSIF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|