C21H23ClN2O2 — CID 57381292
4-[4-(dimethylamino)anilino]-7,8,9,10-tetrahydrobenzo[h]chromen-2-one;hydrochloride (PubChem CID 57381292) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 4-[4-(dimethylamino)anilino]-7,8,9,10-tetrahydrobenzo[h]chromen-2-one;hydrochloride.
| Compound Name | 4-[4-(dimethylamino)anilino]-7,8,9,10-tetrahydrobenzo[h]chromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 57381292 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-[4-(dimethylamino)anilino]-7,8,9,10-tetrahydrobenzo[h]chromen-2-one;hydrochloride |
| SMILES | CN(C)c1ccc(Nc2cc(=O)oc3c4c(ccc23)CCCC4)cc1.Cl |
| InChI | InChI=1S/C21H22N2O2.ClH/c1-23(2)16-10-8-15(9-11-16)22-19-13-20(24)25-21-17-6-4-3-5-14(17)7-12-18(19)21;/h7-13,22H,3-6H2,1-2H3;1H |
| InChIKey | CEJDCLBGCMSLRL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|