C25H44O5Si — CID 57381367
diethyl (3S,3aR,4S,5R)-2,2-ditert-butyl-3-methyl-7-propan-2-yl-3a,4,5,6-tetrahydro-3H-1,2-benzoxasilole-4,5-dicarboxylate (PubChem CID 57381367) has the molecular formula C25H44O5Si and a molecular weight of 452.71 g/mol. Its IUPAC name is diethyl (3S,3aR,4S,5R)-2,2-ditert-butyl-3-methyl-7-propan-2-yl-3a,4,5,6-tetrahydro-3H-1,2-benzoxasilole-4,5-dicarboxylate.
| Compound Name | diethyl (3S,3aR,4S,5R)-2,2-ditert-butyl-3-methyl-7-propan-2-yl-3a,4,5,6-tetrahydro-3H-1,2-benzoxasilole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 57381367 |
| Molecular Formula | C25H44O5Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | diethyl (3S,3aR,4S,5R)-2,2-ditert-butyl-3-methyl-7-propan-2-yl-3a,4,5,6-tetrahydro-3H-1,2-benzoxasilole-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C(=C(C(C)C)C[C@H]1C(=O)OCC)O[Si](C(C)(C)C)(C(C)(C)C)[C@H]2C |
| InChI | InChI=1S/C25H44O5Si/c1-12-28-22(26)18-14-17(15(3)4)21-19(20(18)23(27)29-13-2)16(5)31(30-21,24(6,7)8)25(9,10)11/h15-16,18-20H,12-14H2,1-11H3/t16-,18+,19+,20-/m0/s1 |
| InChIKey | YXRRDFOJSONDPU-NBYUQASBSA-N |
| XLogP | 6.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|