About tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate
tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate (PubChem CID 57382033) has the molecular formula C23H43NO3
and a molecular weight of 381.60 g/mol. Its IUPAC name is tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate |
| PubChem CID | 57382033 |
| Molecular Formula | C23H43NO3 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.32 |
| IUPAC Name | tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate |
| SMILES | CCCCCC[C@H](O)CC[C@@H]1CCCC[C@]12CCCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H43NO3/c1-5-6-7-8-13-20(25)15-14-19-12-9-10-16-23(19)17-11-18-24(23)21(26)27-22(2,3)4/h19-20,25H,5-18H2,1-4H3/t19-,20-,23-/m0/s1 |
| InChIKey | SFEWVUKKMGZKRU-JTAQYXEDSA-N |
| XLogP | 6.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate?
The IUPAC name of tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate (CID 57382033) is tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate.
What is the SMILES notation for tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate?
The canonical SMILES for tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate is CCCCCC[C@H](O)CC[C@@H]1CCCC[C@]12CCCN2C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate?
The InChIKey is SFEWVUKKMGZKRU-JTAQYXEDSA-N. The full InChI is InChI=1S/C23H43NO3/c1-5-6-7-8-13-20(25)15-14-19-12-9-10-16-23(19)17-11-18-24(23)21(26)27-22(2,3)4/h19-20,25H,5-18H2,1-4H3/t19-,20-,23-/m0/s1.
What are the key properties of tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate?
tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate has a molecular weight of 381.60 g/mol, XLogP of 6.06, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (5S,6S)-6-[(3S)-3-hydroxynonyl]-1-azaspiro[4.5]decane-1-carboxylate is sourced from PubChem (CID 57382033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).