C39H78N2O4Si2 — CID 57382035
tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[(1R,2S)-1-cyano-2-[(3S)-3-tri(propan-2-yl)silyloxynonyl]cyclohexyl]carbamate (PubChem CID 57382035) has the molecular formula C39H78N2O4Si2 and a molecular weight of 695.23 g/mol. Its IUPAC name is tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[(1R,2S)-1-cyano-2-[(3S)-3-tri(propan-2-yl)silyloxynonyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[(1R,2S)-1-cyano-2-[(3S)-3-tri(propan-2-yl)silyloxynonyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 57382035 |
| Molecular Formula | C39H78N2O4Si2 |
| Molecular Weight | 695.23 g/mol |
| Exact Mass | 694.55 |
| IUPAC Name | tert-butyl N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[(1R,2S)-1-cyano-2-[(3S)-3-tri(propan-2-yl)silyloxynonyl]cyclohexyl]carbamate |
| SMILES | CCCCCC[C@@H](CC[C@@H]1CCCC[C@@]1(C#N)N(CCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C39H78N2O4Si2/c1-16-17-18-19-24-35(45-47(31(2)3,32(4)5)33(6)7)26-25-34-23-20-21-27-39(34,30-40)41(36(42)44-37(8,9)10)28-22-29-43-46(14,15)38(11,12)13/h31-35H,16-29H2,1-15H3/t34-,35-,39-/m0/s1 |
| InChIKey | RGJAYDPAYVUZBW-FOHSLPDOSA-N |
| XLogP | 12.40 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.23 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|