C12H16ClF2NO4 — CID 57382285
(1R,4R,5S)-4-(2-chloroethyl)-1-[(1R)-2,2-difluoro-1-hydroxybutyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 57382285) has the molecular formula C12H16ClF2NO4 and a molecular weight of 311.71 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-1-[(1R)-2,2-difluoro-1-hydroxybutyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(1R)-2,2-difluoro-1-hydroxybutyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 57382285 |
| Molecular Formula | C12H16ClF2NO4 |
| Molecular Weight | 311.71 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(1R)-2,2-difluoro-1-hydroxybutyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CCC(F)(F)[C@H](O)[C@@]12NC(=O)[C@H](CCCl)[C@]1(C)OC2=O |
| InChI | InChI=1S/C12H16ClF2NO4/c1-3-11(14,15)8(18)12-9(19)20-10(12,2)6(4-5-13)7(17)16-12/h6,8,18H,3-5H2,1-2H3,(H,16,17)/t6-,8-,10-,12-/m0/s1 |
| InChIKey | RIMQLNBDJYBBNP-UYHJVYHKSA-N |
| XLogP | 0.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.71 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|