About 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole
2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole (PubChem CID 57382438) has the molecular formula C16H11FN4S2
and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole |
| PubChem CID | 57382438 |
| Molecular Formula | C16H11FN4S2 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole |
| SMILES | Fc1ccc(-n2cc(CSc3nc4ccccc4s3)nn2)cc1 |
| InChI | InChI=1S/C16H11FN4S2/c17-11-5-7-13(8-6-11)21-9-12(19-20-21)10-22-16-18-14-3-1-2-4-15(14)23-16/h1-9H,10H2 |
| InChIKey | AEUZPURMUGHSJT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole?
The IUPAC name of 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole (CID 57382438) is 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole?
The canonical SMILES for 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole is Fc1ccc(-n2cc(CSc3nc4ccccc4s3)nn2)cc1.
What is the InChIKey of 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole?
The InChIKey is AEUZPURMUGHSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11FN4S2/c17-11-5-7-13(8-6-11)21-9-12(19-20-21)10-22-16-18-14-3-1-2-4-15(14)23-16/h1-9H,10H2.
What are the key properties of 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole?
2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole has a molecular weight of 342.42 g/mol, XLogP of 4.31, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(4-fluorophenyl)triazol-4-yl]methylsulfanyl]-1,3-benzothiazole is sourced from PubChem (CID 57382438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).