C44H10F20N4O2Zn — CID 57382446
zinc (2R,3S)-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-2,3-dihydroporphyrin-22,24-diide-2,3-diol (PubChem CID 57382446) has the molecular formula C44H10F20N4O2Zn and a molecular weight of 1071.94 g/mol. Its IUPAC name is zinc (2R,3S)-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-2,3-dihydroporphyrin-22,24-diide-2,3-diol.
| Compound Name | zinc (2R,3S)-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-2,3-dihydroporphyrin-22,24-diide-2,3-diol |
|---|---|
| PubChem CID | 57382446 |
| Molecular Formula | C44H10F20N4O2Zn |
| Molecular Weight | 1071.94 g/mol |
| Exact Mass | 1069.98 |
| IUPAC Name | zinc (2R,3S)-5,10,15,20-tetrakis(2,3,4,5,6-pentafluorophenyl)-2,3-dihydroporphyrin-22,24-diide-2,3-diol |
| SMILES | O[C@@H]1c2nc(c(-c3c(F)c(F)c(F)c(F)c3F)c3ccc([n-]3)c(-c3c(F)c(F)c(F)c(F)c3F)c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([n-]4)c2-c2c(F)c(F)c(F)c(F)c2F)C=C3)[C@@H]1O.[Zn+2] |
| InChI | InChI=1S/C44H10F20N4O2.Zn/c45-21-17(22(46)30(54)37(61)29(21)53)13-7-1-2-8(65-7)14(18-23(47)31(55)38(62)32(56)24(18)48)10-4-6-12(67-10)16(20-27(51)35(59)40(64)36(60)28(20)52)42-44(70)43(69)41(68-42)15(11-5-3-9(13)66-11)19-25(49)33(57)39(63)34(58)26(19)50;/h1-6,43-44,69-70H;/q-2;+2/b13-7+,13-9+,14-8+,14-10+,15-11-,16-12-,41-15+,42-16+;/t43-,44+; |
| InChIKey | VJSLTZHGQUQZEY-FYOLDBHVSA-N |
| XLogP | 11.96 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1071.94 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|