C28H52N4 — CID 57382579
(1R,4S,6R,9S,11R,14S,16R,19S)-5,5,10,10,15,15,20,20-octamethyl-1,2,3,4,6,7,8,9,11,12,13,14,16,17,18,19,21,22,23,24-icosahydroporphyrin (PubChem CID 57382579) has the molecular formula C28H52N4 and a molecular weight of 444.75 g/mol. Its IUPAC name is (1R,4S,6R,9S,11R,14S,16R,19S)-5,5,10,10,15,15,20,20-octamethyl-1,2,3,4,6,7,8,9,11,12,13,14,16,17,18,19,21,22,23,24-icosahydroporphyrin.
| Compound Name | (1R,4S,6R,9S,11R,14S,16R,19S)-5,5,10,10,15,15,20,20-octamethyl-1,2,3,4,6,7,8,9,11,12,13,14,16,17,18,19,21,22,23,24-icosahydroporphyrin |
|---|---|
| PubChem CID | 57382579 |
| Molecular Formula | C28H52N4 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 444.42 |
| IUPAC Name | (1R,4S,6R,9S,11R,14S,16R,19S)-5,5,10,10,15,15,20,20-octamethyl-1,2,3,4,6,7,8,9,11,12,13,14,16,17,18,19,21,22,23,24-icosahydroporphyrin |
| SMILES | CC1(C)[C@@H]2CC[C@@H](N2)C(C)(C)[C@@H]2CC[C@@H](N2)C(C)(C)[C@@H]2CC[C@@H](N2)C(C)(C)[C@@H]2CC[C@H]1N2 |
| InChI | InChI=1S/C28H52N4/c1-25(2)17-9-11-19(29-17)26(3,4)21-13-15-23(31-21)28(7,8)24-16-14-22(32-24)27(5,6)20-12-10-18(25)30-20/h17-24,29-32H,9-16H2,1-8H3/t17-,18+,19+,20-,21-,22+,23+,24- |
| InChIKey | GRJMASHDKHWJBU-VKFXDHOHSA-N |
| XLogP | 4.59 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |