About adamantane-1,3-diol
adamantane-1,3-diol (PubChem CID 573829) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is adamantane-1,3-diol.
Molecular Properties
| Compound Name | adamantane-1,3-diol |
| PubChem CID | 573829 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | adamantane-1,3-diol |
| SMILES | OC12CC3CC(C1)CC(O)(C3)C2 |
| InChI | InChI=1S/C10H16O2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8,11-12H,1-6H2 |
| InChIKey | MOLCWHCSXCKHAP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze adamantane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-1,3-diol?
The IUPAC name of adamantane-1,3-diol (CID 573829) is adamantane-1,3-diol.
What is the SMILES notation for adamantane-1,3-diol?
The canonical SMILES for adamantane-1,3-diol is OC12CC3CC(C1)CC(O)(C3)C2.
What is the InChIKey of adamantane-1,3-diol?
The InChIKey is MOLCWHCSXCKHAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c11-9-2-7-1-8(4-9)5-10(12,3-7)6-9/h7-8,11-12H,1-6H2.
What are the key properties of adamantane-1,3-diol?
adamantane-1,3-diol has a molecular weight of 168.24 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-1,3-diol is sourced from PubChem (CID 573829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).